For research use only. Not for therapeutic Use.
Benzyl (2-(2-(2-bromoethoxy)ethoxy)ethyl)carbamate(CAT: L001103) is a chemically intricate compound with noteworthy applications. Its synthesis involves the introduction of a carbamate functional group, offering a potential handle for further chemical transformations. This compound serves as a valuable building block in organic synthesis, enabling the creation of complex molecular architectures. Its mode of action involves participation in various chemical reactions, leading to the formation of novel compounds with tailored properties for use in medicinal chemistry, materials science, and chemical research.
Catalog Number | L001103 |
CAS Number | 2100283-00-7 |
Molecular Formula | C14H20BrNO4 |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | benzyl N-[2-[2-(2-bromoethoxy)ethoxy]ethyl]carbamate |
InChI | InChI=1S/C14H20BrNO4/c15-6-8-18-10-11-19-9-7-16-14(17)20-12-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,16,17) |
InChIKey | GRGPUJRSMCXZNT-UHFFFAOYSA-N |