Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
Benzyl ((2R,4R)-2-methylpiperidin-4-yl)carbamate
For research use only. Not for therapeutic Use.
Benzyl ((2R,4R)-2-methylpiperidin-4-yl)carbamate(CAT: L000430) is a significant compound in pharmaceutical chemistry. This molecule serves as a crucial intermediate in the synthesis of pharmaceutical agents. Its structure, incorporating a piperidine ring and a carbamate group, is instrumental in modulating various biological targets, making it valuable for drug discovery and development.
Catalog Number | L000430 |
CAS Number | 2409589-97-3 |
Molecular Formula | C14H20N2O2 |
Purity | ≥95% |
IUPAC Name | benzyl N-[(2R,4R)-2-methylpiperidin-4-yl]carbamate |
InChI | InChI=1S/C14H20N2O2/c1-11-9-13(7-8-15-11)16-14(17)18-10-12-5-3-2-4-6-12/h2-6,11,13,15H,7-10H2,1H3,(H,16,17)/t11-,13-/m1/s1 |
InChIKey | KLFYFYJXRLTUNU-DGCLKSJQSA-N |