For research use only. Not for therapeutic Use.
Benzyl (3-bromophenyl)carbamate (CAT: L000166) is a significant chemical compound with applications in organic chemistry and pharmaceutical research. Its action mechanism involves acting as a carbamate derivative, making it valuable in various chemical reactions. In organic chemistry, this compound serves as a versatile building block for the synthesis of pharmaceutical intermediates. It plays a crucial role in the design and development of potential drugs, making it an essential component in the pharmaceutical industry.
CAS Number | 361337-08-8 |
Molecular Formula | C14H12BrNO2 |
Purity | ≥95% |
IUPAC Name | benzyl N-(3-bromophenyl)carbamate |
InChI | InChI=1S/C14H12BrNO2/c15-12-7-4-8-13(9-12)16-14(17)18-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,16,17) |
InChIKey | RKTXDGRJOLJFAG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |