Home
>
Chemical Reagents>Organometallic Reagents> Benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-YL)benzoate
For research use only. Not for therapeutic Use.
Benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (Cat.No:L003629) is a crucial compound in organic synthesis. Its unique structure, incorporating a boron-containing moiety, makes it a versatile reagent for cross-coupling reactions, especially in pharmaceutical and materials research. This compound serves as a valuable building block for the creation of specialized materials, emphasizing its significance in contemporary chemical endeavors and its role in advancing innovative materials for various applications.
CAS Number | 934984-01-7 |
Molecular Formula | C20H23BO4 |
Purity | ≥95% |
IUPAC Name | benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
InChI | InChI=1S/C20H23BO4/c1-19(2)20(3,4)25-21(24-19)17-12-10-16(11-13-17)18(22)23-14-15-8-6-5-7-9-15/h5-13H,14H2,1-4H3 |
InChIKey | OJRYYUUOHDTXEW-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OCC3=CC=CC=C3 |