For research use only. Not for therapeutic Use.
Benzyl 4-hydroxyazepane-1-carboxylate(Cat No.:L019701)is an organic compound used in pharmaceutical research and organic synthesis. It features an azepane ring with a hydroxyl group at the 4-position and a benzyl ester attached to the 1-position. This structure provides unique reactivity, making it valuable as an intermediate in the synthesis of complex molecules, including potential drug candidates. The hydroxyl and ester functionalities allow for versatile chemical modifications, making this compound essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
CAS Number | 648418-25-1 |
Molecular Formula | C14H19NO3 |
Purity | ≥95% |
IUPAC Name | benzyl 4-hydroxyazepane-1-carboxylate |
InChI | InChI=1S/C14H19NO3/c16-13-7-4-9-15(10-8-13)14(17)18-11-12-5-2-1-3-6-12/h1-3,5-6,13,16H,4,7-11H2 |
InChIKey | GJXUQWPNVHGPQC-UHFFFAOYSA-N |
SMILES | C1CC(CCN(C1)C(=O)OCC2=CC=CC=C2)O |