For research use only. Not for therapeutic Use.
Benzyl (4-iodocyclohexyl)carbamate(CAT: L021123) is a high-purity compound essential for pharmaceutical and chemical research. Featuring a carbamate group linked to a benzyl moiety and a 4-iodocyclohexyl core, it serves as a versatile intermediate in drug discovery and synthesis of bioactive molecules. Its unique structure enables its use in developing small-molecule inhibitors, radiolabeling precursors, and functionalized therapeutic candidates. With excellent stability and reactivity, Benzyl (4-iodocyclohexyl)carbamate supports complex organic transformations and target-specific optimizations. Ideal for advanced medicinal chemistry and industrial research, it ensures precision and efficiency in innovative compound development.
Catalog Number | L021123 |
CAS Number | 1353970-61-2 |
Molecular Formula | C14H18INO2 |
Purity | ≥95% |
IUPAC Name | benzyl N-(4-iodocyclohexyl)carbamate |
InChI | InChI=1S/C14H18INO2/c15-12-6-8-13(9-7-12)16-14(17)18-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,16,17) |
InChIKey | JFTNWQVLMRFZNZ-UHFFFAOYSA-N |
SMILES | C1CC(CCC1NC(=O)OCC2=CC=CC=C2)I |