For research use only. Not for therapeutic Use.
Benzyl 6-hydroxyhexanoate (Cat No.:C000910) is an organic compound. It is a colorless to pale yellow liquid and belongs to the family of esters. This compound is used as a building block and reagent in organic synthesis, particularly in the production of various chemical compounds and pharmaceuticals. It contains both a benzyl and a hydroxy hexanoate functional group, making it valuable in various chemical reactions to form different derivatives. Benzyl 6-hydroxyhexanoate is a versatile reagent in organic chemistry, offering efficient and selective reactions.
| Catalog Number | C000910 |
| CAS Number | 125878-06-0 |
| Synonyms | Benzyl 6-Hydroxycaproate; 6-Hydroxy-hexanoic Acid Phenylmethyl Ester |
| Molecular Formula | C₁₃H₁₈O₃ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Appearance | Colorless Oil |
| Storage | 4°C |
| IUPAC Name | benzyl 6-hydroxyhexanoate |
| InChI | InChI=1S/C13H18O3/c14-10-6-2-5-9-13(15)16-11-12-7-3-1-4-8-12/h1,3-4,7-8,14H,2,5-6,9-11H2 |
| InChIKey | OODHJPDDRCGXMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCCO |
| Reference | HettKamp, H., et al.: Eur. J. Biochem., 142, 85 (1984); Shailubhai, K., et al.: Biochem. J., 247, 555 (1987); Bause, E., et al.: FEBS, 278, 167 (1991) |
