For research use only. Not for therapeutic Use.
Benzyl Bromide-13C6(Cat No.:R027789) is a high-purity isotopically labeled compound essential for advanced research in organic synthesis and reaction mechanisms. This version of Benzyl Bromide features six carbon-13 atoms, making it crucial for studies involving carbon tracking, metabolic pathways, and molecular interactions. Its stable isotope labeling ensures precise and reliable analytical results, suitable for various experimental setups. Ideal for applications in NMR spectroscopy, tracer studies, and synthetic chemistry, Benzyl Bromide-13C6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 286013-10-3 |
Synonyms | α-Bromotoluene-13C6; (Bromomethyl)benzene-13C6; (Bromophenyl)methane-13C6; 1-(Bromomethyl)benzene-13C6; Benzyl Bromide-13C6; NSC 8041-13C6; Phenylmethyl Bromide-13C6; α-Bromotoluene-13C6; ω-Bromotoluene-13C6; (Bromomethyl)-benzene-13C6 |
Molecular Formula | C7H7Br |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bromomethyl(1,2,3,4,5,6-13C6)cyclohexatriene |
InChI | InChI=1S/C7H7Br/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1+1,2+1,3+1,4+1,5+1,7+1 |
InChIKey | AGEZXYOZHKGVCM-ZXJNGCBISA-N |
SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)CBr |