For research use only. Not for therapeutic Use.
Benzyl butyl phthalate-d4 (Cat No.:R051558) is a deuterated analog of benzyl butyl phthalate (BBP), where hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. This modification makes BBP-d4 useful in analytical techniques, particularly in environmental and toxicological studies, where its traceability can help monitor the presence and behavior of BBP in different systems. BBP is a commonly used plasticizer, enhancing flexibility in materials such as PVC, adhesives, and coatings. The deuterated version is primarily employed in research to investigate the compound’s fate and potential effects.
| Catalog Number | R051558 |
| CAS Number | 93951-88-3 |
| Synonyms | 2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Formula | C19H16D4O4 |
| Purity | ≥95% |
| IUPAC Name | 2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChI | InChI=1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3/i7D,8D,11D,12D |
| InChIKey | IRIAEXORFWYRCZ-CXRURWBMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCC)C(=O)OCC2=CC=CC=C2)[2H])[2H] |
