For research use only. Not for therapeutic Use.
Benzyl Carbazate (Cat.No:R058303) is a chemical compound widely utilized in organic synthesis. It serves as a versatile building block for the preparation of various compounds, including pharmaceuticals and agrochemicals. Benzyl Carbazate’s reactivity and stability make it a valuable tool in the development of novel molecules for diverse applications.
| Catalog Number | R058303 |
| CAS Number | 5331-43-1 |
| Synonyms | Carbazic Acid Benzyl Ester; Benzyl Carbazate; Benzyl Hydrazinecarboxylate; Benzyl Hydrazinocarboxylate; Benzyloxycarbonyl Hydrazide; Carbobenzoxyhydrazide; Carbobenzyloxyhydrazine; Hydrazincarboxylic Acid Benzyl Ester; Hydrazinecarboxylic Acid Benzyl |
| Molecular Formula | C8H10N2O2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | benzyl N-aminocarbamate |
| InChI | InChI=1S/C8H10N2O2/c9-10-8(11)12-6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11) |
| InChIKey | RXUBZLMIGSAPEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NN |
