For research use only. Not for therapeutic Use.
Benzyl DC-81(Cat No.:I041275)is an experimental chemical compound that is primarily being studied for its potential applications in medicinal chemistry. It is a derivative of the DC-81 class of molecules, known for its bioactive properties. Benzyl DC-81 has shown promise in preclinical studies for its ability to modulate specific cellular pathways involved in disease processes, such as inflammation and cell growth. Its therapeutic potential is being explored in areas like cancer, autoimmune diseases, and other conditions characterized by dysregulated cellular processes. Research is ongoing to evaluate its safety and efficacy in clinical settings.
CAS Number | 127810-79-1 |
Synonyms | (6aS)-2-methoxy-3-phenylmethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
Molecular Formula | C20H20N2O3 |
Purity | ≥95% |
IUPAC Name | (6aS)-2-methoxy-3-phenylmethoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
InChI | InChI=1S/C20H20N2O3/c1-24-18-10-16-17(21-12-15-8-5-9-22(15)20(16)23)11-19(18)25-13-14-6-3-2-4-7-14/h2-4,6-7,10-12,15H,5,8-9,13H2,1H3/t15-/m0/s1 |
InChIKey | PXXBSLZVZRNTAD-HNNXBMFYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=O)N3CCC[C@H]3C=N2)OCC4=CC=CC=C4 |