For research use only. Not for therapeutic Use.
Benzyl glycolate is an ester compound formed from benzyl alcohol and glycolic acid. It finds applications in the fragrance and flavor industry due to its pleasant, fruity odor reminiscent of pear. Additionally, benzyl glycolate is utilized in cosmetics and personal care products as a fragrance ingredient. Its versatility and pleasant aroma make it a valuable component in various consumer products.
| Catalog Number | R042328 |
| CAS Number | 30379-58-9 |
| Synonyms | Glycolic Acid Benzyl Ester (8CI); Benzyl 2-Hydroxyacetate; Benzyl glycolate; Hydroxyacetic Acid Benzyl Ester; Hydroxy Acetic Acid Phenylmethyl Ester; |
| Molecular Formula | C9H10O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | benzyl 2-hydroxyacetate |
| InChI | InChI=1S/C9H10O3/c10-6-9(11)12-7-8-4-2-1-3-5-8/h1-5,10H,6-7H2 |
| InChIKey | VPYJBEIOKFRWQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CO |
