For research use only. Not for therapeutic Use.
Benzyl N-[2-(trifluoromethoxy)ethyl]carbamate(Cat No.:L007531), is a chemical compound characterized by a carbamate group attached to a benzyl moiety, and an ethyl group linked to a trifluoromethoxy group. This compound holds importance in organic synthesis and pharmaceutical research. Its unique structure and reactivity make it valuable for creating diverse organic molecules, including potential drug candidates. Researchers explore its interactions and biological activities, aiming to develop novel medications.
CAS Number | 1919864-85-9 |
Molecular Formula | C11H13F2NO3 |
Purity | ≥95% |
IUPAC Name | benzyl N-[2-(difluoromethoxy)ethyl]carbamate |
InChI | InChI=1S/C11H13F2NO3/c12-10(13)16-7-6-14-11(15)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15) |
InChIKey | RMDSDZBUKXSSBR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)NCCOC(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |