For research use only. Not for therapeutic Use.
Benzyl phenyl sulfide（Cat No.:L047158）is a high-purity organic compound commonly used in pharmaceutical and chemical research. This molecule features a sulfide bond connecting a benzyl group and a phenyl group, making it a versatile intermediate in the synthesis of more complex organic molecules, including potential drug candidates and specialty chemicals. Its unique structure and reactivity allow for various chemical transformations, making Benzyl phenyl sulfide valuable in the development of new materials and compounds. It is ideal for precise synthetic applications in medicinal chemistry and advanced research.
| Catalog Number | L047158 |
| CAS Number | 831-91-4 |
| Molecular Formula | C13H12S |
| Purity | ≥95% |
| IUPAC Name | benzylsulfanylbenzene |
| InChI | InChI=1S/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | LKMCJXXOBRCATQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC=CC=C2 |
