For research use only. Not for therapeutic Use.
Benzyl tert-butyl ethane-1,2-diyldicarbamate(Cat No.:L036855)is a protective group derivative used extensively in organic synthesis, particularly in peptide and pharmaceutical chemistry. This compound features a benzyl and a tert-butyl group attached to an ethane-1,2-diyldicarbamate backbone, providing stability and protecting functionality during complex synthetic processes. It is commonly employed to safeguard amine groups from unwanted reactions, allowing for selective deprotection later in the synthesis. Benzyl tert-butyl ethane-1,2-diyldicarbamate is crucial for researchers developing new compounds with precise structural and functional requirements.
CAS Number | 77153-05-0 |
Molecular Formula | C15H22N2O4 |
Purity | ≥95% |
IUPAC Name | benzyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamate |
InChI | InChI=1S/C15H22N2O4/c1-15(2,3)21-14(19)17-10-9-16-13(18)20-11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,16,18)(H,17,19) |
InChIKey | KSRSLPBOKBJBBE-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NCCNC(=O)OCC1=CC=CC=C1 |