For research use only. Not for therapeutic Use.
Benzyl (triphenylphosphoranylidene)acetate (Cat.No:M063280) is a chemical compound utilized in organic synthesis. It serves as a versatile reagent in various reactions, including the Wittig reaction, facilitating the formation of carbon-carbon double bonds. This compound plays a crucial role in the construction of complex organic molecules in research and industrial applications.
CAS Number | 15097-38-8 |
Molecular Formula | C27H23O2P |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | benzyl 2-(triphenyl-$l^{5} |
InChI | InChI=1S/C27H23O2P/c28-27(29-21-23-13-5-1-6-14-23)22-30(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,22H,21H2 |
InChIKey | INKMLGJBBDRIQR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)C=P(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |