For research use only. Not for therapeutic Use.
Benzyl trisulfide (Cat.No:R051006) is an organic compound found in various plant sources, including garlic. It exhibits potential antimicrobial, antifungal, and anticancer properties. Benzyl trisulfide’s biological activities make it a subject of interest in medical and agricultural research, particularly for its natural defense mechanisms and potential therapeutic applications.
CAS Number | 6493-73-8 |
Synonyms | Bis(phenylmethyl)trisulfide; Dibenzyl Trisulfide; |
Molecular Formula | C14H14S3 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | (benzyltrisulfanyl)methylbenzene |
InChI | InChI=1S/C14H14S3/c1-3-7-13(8-4-1)11-15-17-16-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
InChIKey | UXDMWYANCHMSJX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CSSSCC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |