For research use only. Not for therapeutic Use.
Benzylamine-d5 is a deuterated form of benzylamine, with five deuterium atoms incorporated into its molecular structure. This high-purity isotopically labeled compound is essential for advanced research in organic synthesis, pharmacology, and analytical chemistry. Benzylamine-d5 is particularly valuable for studying reaction mechanisms, metabolic pathways, and the behavior of amines in various chemical environments. The deuterium labeling allows for precise tracking and quantification in analytical techniques such as NMR spectroscopy and mass spectrometry, enhancing the accuracy of results in complex systems. This compound is a critical tool for researchers working on the synthesis of labeled compounds, drug development, and the exploration of amine chemistry, providing consistent and reliable outcomes in various experimental applications.
CAS Number | 1219802-81-9 |
Synonyms | Benzyl-2,3,4,5,6-d5-amine |
Molecular Formula | C7H9N |
Purity | ≥95% |
Storage | room temperature |
Related CAS | 100-46-9 |
IUPAC Name | (2,3,4,5,6-pentadeuteriophenyl)methanamine |
InChI | InChI=1S/C7H9N/c8-6-7-4-2-1-3-5-7/h1-5H,6,8H2/i1D,2D,3D,4D,5D |
InChIKey | WGQKYBSKWIADBV-RALIUCGRSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CN)[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |