For research use only. Not for therapeutic Use.
Benzyldimethylsilane (Cat.No:M119443) is a versatile organosilicon compound used in various chemical reactions, particularly in cross-coupling reactions in organic synthesis. Its unique structure, containing a silicon atom bonded to a benzyl group, imparts distinct reactivity and selectivity, making it a valuable reagent in modern synthetic chemistry.
| Catalog Number | M119443 |
| CAS Number | 1631-70-5 |
| Molecular Formula | C9H13Si |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | benzyl(dimethyl)silicon |
| InChI | InChI=1S/C9H13Si/c1-10(2)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | SKDKWDVYZOKBPL-UHFFFAOYSA-N |
| SMILES | C[Si](C)CC1=CC=CC=C1 |
