For research use only. Not for therapeutic Use.
Benzyloxyacetaldehyde dimethyl acetal is an organic compound featuring a benzyloxy group attached to an acetaldehyde moiety, with two methoxy groups (–OCH3) as protecting groups on the aldehyde. The benzyloxy group imparts aromaticity, while the methoxy groups provide steric protection, preventing aldehyde reactivity. This compound is commonly used as a reagent or intermediate in organic synthesis, particularly in the protection of aldehydes during multistep reactions. It can be employed in the synthesis of more complex molecules, such as pharmaceuticals and fine chemicals.
Catalog Number | M111122 |
CAS Number | 127657-97-0 |
Molecular Formula | C11H16O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2-dimethoxyethoxymethylbenzene |
InChI | InChI=1S/C11H16O3/c1-12-11(13-2)9-14-8-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
InChIKey | QITBBLPNYKECAZ-UHFFFAOYSA-N |
SMILES | COC(COCC1=CC=CC=C1)OC |