For research use only. Not for therapeutic Use.
Benzyltrimethylammonium iodide is a quaternary ammonium salt featuring a benzyl group attached to a trimethylammonium cation, with iodide as the counterion. This compound exhibits interesting properties due to its ionic nature, making it useful as a phase transfer catalyst in organic synthesis. The benzyl group enhances lipophilicity, facilitating the transfer of reactants between aqueous and organic phases. Its ability to stabilize charged species makes it valuable in various chemical reactions, including alkylation and nucleophilic substitutions in synthetic chemistry.
| Catalog Number | L047139 |
| CAS Number | 4525-46-6 |
| Molecular Formula | C10H16IN |
| Purity | ≥95% |
| IUPAC Name | benzyl(trimethyl)azanium;iodide |
| InChI | InChI=1S/C10H16N.HI/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LRRJQNMXIDXNIM-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.[I-] |
