For research use only. Not for therapeutic Use.
Berberine(Cat No.:R027749)is a bioactive alkaloid derived from various plants, including Berberis species. Known for its wide-ranging pharmacological properties, berberine exhibits significant antibacterial, anti-inflammatory, and antidiabetic effects. It functions by activating AMP-activated protein kinase (AMPK), promoting metabolic regulation and glucose homeostasis. Additionally, berberine has been studied for its potential role in cardiovascular health and lipid metabolism, making it a promising candidate in natural product research. Its ability to influence gut microbiota further enhances its therapeutic potential, positioning berberine as a valuable compound in integrative and conventional medicine.
CAS Number | 2086-83-1 |
Molecular Formula | C20H18NO4+ |
Purity | ≥95% |
Target | Autophagy |
IUPAC Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
InChI | InChI=1S/C20H18NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,7-10H,5-6,11H2,1-2H3/q+1 |
InChIKey | YBHILYKTIRIUTE-UHFFFAOYSA-N |
SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |