For research use only. Not for therapeutic Use.
Berberine sulfate(Cat No.:R025016)is a bioactive compound derived from several plants, including goldenseal and barberry, known for its diverse pharmacological properties. This alkaloid exhibits anti-inflammatory, antimicrobial, and antidiabetic effects, making it a valuable agent in traditional and modern medicine. Berberine sulfate helps regulate glucose metabolism, improve insulin sensitivity, and promote weight loss, offering potential benefits for managing type 2 diabetes and metabolic syndrome. Additionally, it has been studied for its anticancer properties, showing promise in inhibiting tumor growth. Ongoing research continues to explore its mechanisms of action and therapeutic applications across various health conditions.
Catalog Number | R025016 |
CAS Number | 633-66-9 |
Synonyms | 7,8,13,13a-tetradehydro-9,10-dimethoxy-2,3-(methylenedioxy)Berbinium Sulfate;?Berberine Bisulfate; Berberine Hemisulfate; Berberine Hydrogen Sulfate; Berberine Sulfate; Berberine Sulfate (1:1); NSC 150444 |
Molecular Formula | C20H19NO8S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene;hydrogen sulfate |
InChI | InChI=1S/C20H18NO4.H2O4S/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;1-5(2,3)4/h3-4,7-10H,5-6,11H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
InChIKey | JISRTQBQFQMSLG-UHFFFAOYSA-M |
SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.OS(=O)(=O)[O-] |