For research use only. Not for therapeutic Use.
Bergamottin (CAT: R058715) is a natural furanocoumarin compound found in various citrus fruits such as grapefruit, lemon, lime, and bergamot. It exhibits diverse biological activities, including inhibiting the cytochrome P450 enzyme CYP3A4 and the drug transporter P-glycoprotein, which play crucial roles in drug metabolism and absorption. As a result, bergamottin can influence the pharmacokinetics of various drugs by altering their metabolism and bioavailability.
Catalog Number | R058715 |
CAS Number | 7380-40-7 |
Synonyms | 4-[[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy]-7H-furo[3,2-g][1]benzopyran-7-one; (E)-4-[(3,7-dimethyl-2,6-octadienyl)oxy]-H-furo[3,2-g][1]benzopyran-7-one; 5-Geranoxypsoralen; Bergamotine; Bergaptin; |
Molecular Formula | C21H22O4 |
Purity | ≥95% |
Target | Cytochrome P450 |
Storage | -20°C |
IUPAC Name | 4-[(2E)-3,7-dimethylocta-2,6-dienoxy]furo[3,2-g]chromen-7-one |
InChI | InChI=1S/C21H22O4/c1-14(2)5-4-6-15(3)9-11-24-21-16-7-8-20(22)25-19(16)13-18-17(21)10-12-23-18/h5,7-10,12-13H,4,6,11H2,1-3H3/b15-9+ |
InChIKey | DBMJZOMNXBSRED-OQLLNIDSSA-N |
SMILES | CC(=CCCC(=CCOC1=C2C=CC(=O)OC2=CC3=C1C=CO3)C)C |