For research use only. Not for therapeutic Use.
BET Bromodomain Inhibitor 3（Cat No.:I041142）is a selective small molecule that targets the bromodomains of BET (bromodomain and extraterminal) proteins, such as BRD2, BRD3, and BRD4. These proteins play a critical role in regulating gene expression by interacting with acetylated histones. By inhibiting BET proteins, BET Bromodomain Inhibitor 3 disrupts transcriptional processes involved in cell cycle regulation, inflammation, and cancer cell proliferation. This compound shows promise in preclinical studies for treating cancers, particularly those with dysregulated transcriptional activity, and offers a potential therapeutic strategy for targeting BET proteins in disease.
| CAS Number | 854137-39-6 |
| Synonyms | 11,13-dimethyl-8-(4-methylphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
| Molecular Formula | C18H17N3O4 |
| Purity | ≥95% |
| IUPAC Name | 11,13-dimethyl-8-(4-methylphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
| InChI | InChI=1S/C18H17N3O4/c1-9-4-6-10(7-5-9)12-13-11(8-25-17(13)23)19-15-14(12)16(22)21(3)18(24)20(15)2/h4-7,12,19H,8H2,1-3H3 |
| InChIKey | AVGOOVXJYOSRNE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C3=C(COC3=O)NC4=C2C(=O)N(C(=O)N4C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
