For research use only. Not for therapeutic Use.
BET-IN-14(Cat No.:I041171)is an experimental small molecule inhibitor designed to target bromodomain and extra-terminal (BET) proteins, which play a key role in regulating gene expression involved in cancer and inflammation. By inhibiting BET proteins, BET-IN-14 aims to suppress the expression of oncogenes and inflammatory mediators, offering potential therapeutic benefits in diseases such as cancer and autoimmune disorders. Preclinical studies have shown promising results, suggesting its potential in overcoming resistance to other therapies. Ongoing clinical trials are evaluating its safety, efficacy, and role in treating various cancers and inflammatory conditions.
CAS Number | 2243669-93-2 |
Synonyms | (3R)-4-cyclopentyl-1,3-dimethyl-6-[2-(4-methylphenyl)-5-(4-methylpiperazine-1-carbonyl)-1,2,4-triazol-3-yl]-3H-quinoxalin-2-one |
Molecular Formula | C30H37N7O2 |
Purity | ≥95% |
IUPAC Name | (3R)-4-cyclopentyl-1,3-dimethyl-6-[2-(4-methylphenyl)-5-(4-methylpiperazine-1-carbonyl)-1,2,4-triazol-3-yl]-3H-quinoxalin-2-one |
InChI | InChI=1S/C30H37N7O2/c1-20-9-12-24(13-10-20)37-28(31-27(32-37)30(39)35-17-15-33(3)16-18-35)22-11-14-25-26(19-22)36(23-7-5-6-8-23)21(2)29(38)34(25)4/h9-14,19,21,23H,5-8,15-18H2,1-4H3/t21-/m1/s1 |
InChIKey | RRASMEQGOOPKTF-OAQYLSRUSA-N |
SMILES | C[C@@H]1C(=O)N(C2=C(N1C3CCCC3)C=C(C=C2)C4=NC(=NN4C5=CC=C(C=C5)C)C(=O)N6CCN(CC6)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |