For research use only. Not for therapeutic Use.
BET-IN-4 (Cat.No:I019234) is a small molecule inhibitor of the bromodomain and extraterminal (BET) family of proteins, which play a role in regulating gene expression. BET-IN-4 has been studied for its potential therapeutic applications in cancer and inflammatory diseases. It has shown to inhibit the growth of cancer cells and decrease inflammation in preclinical studies. Further research is needed to explore its clinical applications.
| Catalog Number | I019234 |
| CAS Number | 1801503-93-4 |
| Molecular Formula | C₂₂H₂₁N₃O₃ |
| Purity | ≥95% |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-7-methoxy-3-methyl-1-(pyridin-2-ylmethyl)quinolin-2-one |
| InChI | InChI=1S/C22H21N3O3/c1-13-9-16-10-18(21-14(2)24-28-15(21)3)20(27-4)11-19(16)25(22(13)26)12-17-7-5-6-8-23-17/h5-11H,12H2,1-4H3 |
| InChIKey | YVGWSVHZXWFLIT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(C=C2N(C1=O)CC3=CC=CC=N3)OC)C4=C(ON=C4C)C |
| Reference | [1]. Susanta Samajdar, et al. Bicyclic heterocyclic derivatives as bromodomain inhibitors. WO2015104653A1 |
