For research use only. Not for therapeutic Use.
Beta-Angelica lactone(CAT: M001580) is an organic compound belonging to the lactone family, characterized by a cyclic ester structure. It is typically derived from the volatile oils of certain plants, such as Angelica species. Beta-Angelica lactone is known for its pleasant aroma and is often studied for its potential applications in the flavor and fragrance industries. Additionally, it exhibits various biological properties, including antimicrobial and anti-inflammatory effects, making it of interest in medicinal research. Its natural origin and bioactivity make it useful in developing eco-friendly products and in the exploration of phytochemicals for health-related applications.
CAS Number | 591-11-7 |
Synonyms | BETA-ANGELICA LACTONE;2-Penten-4-olide;2-Pentenoic acid, 4-hydroxy-, gamma-lactone;4-hydroxy-2-pentanoicacigamma-lactone;4-Hydroxy-2-pentenoic acid gamma-lactone;4-hydroxy-2-pentenoicacidgamma-lactone;4-Hydroxypent-2-enoic acid lactone;4-Methyl-2-but |
Molecular Formula | C5H6O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-methyl-2H-furan-5-one |
InChI | InChI=1S/C5H6O2/c1-4-2-3-5(6)7-4/h2-4H,1H3 |
InChIKey | BGLUXFNVVSVEET-UHFFFAOYSA-N |
SMILES | CC1C=CC(=O)O1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |