For research use only. Not for therapeutic Use.
β‐Carotene（Cat No.:I013866）is a naturally occurring pigment found in fruits and vegetables, known for its vibrant orange color. As a precursor to vitamin A, it plays a crucial role in maintaining healthy vision, skin, and immune function. β‐Carotene is a powerful antioxidant, protecting cells from oxidative damage and reducing the risk of chronic diseases. It is commonly used as a dietary supplement and food additive, enhancing nutritional value and color. Its health benefits and versatile applications make β‐Carotene an essential component in both nutrition and wellness industries.
| Catalog Number | I013866 |
| CAS Number | 7235-40-7 |
| Molecular Formula | C₄₀H₅₆ |
| Purity | ≥95% |
| Target | Apoptosis |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7Z,9Z,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| InChI | InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11-,19-13+,20-14+,27-25+,28-26+,31-17-,32-18+,33-21+,34-22+ |
| InChIKey | OENHQHLEOONYIE-KBPBZLIPSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C |
