For research use only. Not for therapeutic Use.
Beta-cypermethrin(Cat No.:R069302), is a synthetic pyrethroid insecticide used to control a wide range of pests in agriculture, public health, and residential settings. It is an isomer of the popular insecticide cypermethrin. Beta-cypermethrin disrupts nerve function in insects, leading to paralysis and death. It is known for its effectiveness against various insects, including mosquitoes, ants, and agricultural pests.
Catalog Number | R069302 |
CAS Number | 65731-84-2 |
Synonyms | Agrothrin(TM), Ambush C(TM), Ammo(TM), Antiborer 3767(TM), Ardap(TM) |
Molecular Formula | C22H19Cl2NO3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | [(S)-cyano-(3-phenoxyphenyl)methyl] (1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
InChI | InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18+,20-/m0/s1 |
InChIKey | KAATUXNTWXVJKI-NSHGMRRFSA-N |
SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |