For research use only. Not for therapeutic Use.
β-Mangostin(Cat No.:I002607)is a xanthone derivative extracted from the mangosteen fruit (Garcinia mangostana), recognized for its potent antioxidant, anti-inflammatory, and anticancer properties. As a bioactive compound, it targets various cellular pathways, making it promising in the fields of pharmaceutical and nutraceutical research. β-Mangostin has demonstrated efficacy in inhibiting cancer cell proliferation, modulating immune responses, and protecting cells from oxidative damage. Its potential therapeutic benefits extend to managing conditions related to inflammation and oxidative stress, positioning it as a valuable natural compound in health and wellness applications.
CAS Number | 20931-37-7 |
Molecular Formula | C25H28O6 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | Store at -20℃ |
IUPAC Name | 1,6-dihydroxy-3,7-dimethoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
InChI | InChI=1S/C25H28O6/c1-13(2)7-9-15-18(29-5)12-20-22(23(15)27)24(28)21-16(10-8-14(3)4)25(30-6)17(26)11-19(21)31-20/h7-8,11-12,26-27H,9-10H2,1-6H3 |
InChIKey | YRKKJHJIWCRNCW-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C=C2C(=C1O)C(=O)C3=C(O2)C=C(C(=C3CC=C(C)C)OC)O)OC)C |
Reference | <p style=/line-height:25px/> </p> |