For research use only. Not for therapeutic Use.
Beta-sitosterol(Cat No.:I005010)is a plant sterol, a naturally occurring compound found in various plant-based foods such as nuts, seeds, and vegetables. It is chemically similar to cholesterol and is known for its potential health benefits, including supporting heart health by lowering LDL cholesterol levels. Beta-sitosterol also has anti-inflammatory properties and is used in the treatment of benign prostatic hyperplasia (BPH) to improve urinary symptoms. Additionally, it may support immune function and act as an antioxidant. Research continues to explore its effectiveness in various health conditions, particularly its role in lowering cholesterol and improving prostate health.
Catalog Number | I005010 |
CAS Number | 83-46-5 |
Synonyms | Azuprostat;Betaprost;Cupreol;NSC 18173;NSC 49083;NSC 8096;Rhamnol;β-Sitosterol;SKF 14463;22,23-dihydro-Stigmasterol |
Molecular Formula | C29H50O |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO |
Storage | 3 years -20C powder |
IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
InChIKey | KZJWDPNRJALLNS-VJSFXXLFSA-N |
SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C |