For research use only. Not for therapeutic Use.
Betaine salicylate(Cat No.:M074086) is a chemical compound derived from salicylic acid and betaine. It combines the exfoliating properties of salicylic acid with the soothing and hydrating effects of betaine. Betaine salicylate is widely used in skincare products, particularly in exfoliating treatments and anti-acne formulations. It works by penetrating the pores to remove dead skin cells and excess sebum, effectively unclogging pores and preventing acne breakouts. Additionally, betaine salicylate helps to improve skin texture, reduce inflammation, and promote overall skin health, making it a popular ingredient in various cosmetic and dermatological products.
Catalog Number | M074086 |
CAS Number | 17671-53-3 |
Synonyms | BETAINE SALICYLATE |
Molecular Formula | C12H17NO5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | carboxymethyl(trimethyl)azanium;2-carboxyphenolate |
InChI | InChI=1S/C7H6O3.C5H11NO2/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5(7)8/h1-4,8H,(H,9,10);4H2,1-3H3 |
InChIKey | CFXSFDXXYYHZFU-UHFFFAOYSA-N |
SMILES | C[N+](C)(C)CC(=O)O.C1=CC=C(C(=C1)C(=O)O)[O-] |