For research use only. Not for therapeutic Use.
Betamethasone-d5(Cat No.:S000291) is a deuterated form of betamethasone, where five hydrogen atoms are replaced with deuterium, enhancing its molecular stability and making it valuable as an internal standard in analytical methods such as mass spectrometry and NMR spectroscopy. Betamethasone is a potent glucocorticoid steroid used to treat a variety of inflammatory and autoimmune conditions, including allergic reactions, eczema, and psoriasis. The incorporation of deuterium into betamethasone-d5 allows for more precise pharmacokinetic and metabolic studies, providing clearer insights into the drug’s behavior and interactions in biological systems.
Molecular Formula | C22H24D5FO5 |
Purity | ≥95% |
IUPAC Name | (8S,9R,10S,11S,13S,14S,16S,17R)-4,6,6-trideuterio-17-(2,2-dideuterio-2-hydroxyacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-8,11,12,14,15,16-hexahydro-7H-cyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1/i4D2,9D,11D2 |
InChIKey | UREBDLICKHMUKA-PAEDUFRWSA-N |
SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C |