For research use only. Not for therapeutic Use.
Betamicin (Cat.No:I023303) is a type of aminoglycoside antibiotic used to treat bacterial infections. It works by inhibiting protein synthesis in bacteria, leading to their death. Betamicin has a broad spectrum of activity against various Gram-negative and Gram-positive bacteria. Betamicin is generally well-tolerated, but may have potential side effects, such as hearing loss and kidney damage.
CAS Number | 36889-15-3 |
Synonyms | Betamicin; Gentamicin B; Gentamycin B; SCH 14342; SCH14342; SCH-14342 |
Molecular Formula | C19H38N4O10 |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(aminomethyl)-6-(((1R,2R,3S,4R,6S)-4,6-diamino-3-(((2R,3R,4R,5R)-3,5-dihydroxy-5-methyl-4-(methylamino)tetrahydro-2H-pyran-2-yl)oxy)-2-hydroxycyclohexyl)oxy)tetrahydro-2H-pyran-3,4,5-triol |
InChI | InChI=1S/C19H38N4O10/c1-19(29)5-30-17(13(28)16(19)23-2)32-14-6(21)3-7(22)15(12(14)27)33-18-11(26)10(25)9(24)8(4-20)31-18/h6-18,23-29H,3-5,20-22H2,1-2H3/t6-,7+,8-,9-,10+,11-,12-,13-,14+,15-,16-,17-,18-,19+/m1/s1 |
InChIKey | RHRAMPXHWHSKQB-GGEUKFTFSA-N |
SMILES | CN[C@@H]1[C@@H](O)[C@@H](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2O)OC[C@]1(C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |