For research use only. Not for therapeutic Use.
Betaxolol-d5(Cat No.:S000347) is a deuterated version of betaxolol, where five hydrogen atoms are replaced with deuterium. Betaxolol is a beta-blocker used primarily for the treatment of hypertension and glaucoma. The incorporation of deuterium into betaxolol enhances the molecule’s stability and facilitates more precise pharmacokinetic and metabolic studies. This allows researchers to better understand how betaxolol is metabolized and distributed within the body, leading to improved therapeutic management, optimized dosing regimens, and potentially reduced side effects, ultimately enhancing the effectiveness and safety of betaxolol in clinical use.
Catalog Number | S000347 |
CAS Number | 1189957-99-0 |
Molecular Formula | C18H24D5NO3 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-1,1,2,3,3-pentadeuterio-3-(propan-2-ylamino)propan-2-ol |
InChI | InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/i11D2,13D2,17D |
InChIKey | NWIUTZDMDHAVTP-FFNOJTKMSA-N |
SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOCC2CC2)O |