For research use only. Not for therapeutic Use.
Betulin diacetate(CAT: M121023) is a chemical compound derived from betulin, a triterpene found in the bark of birch trees and other plant sources. Its mode of action and pharmacological effects can involve interactions with cellular processes and molecular targets due to its specific chemical structure. Betulin diacetate has been investigated for its potential bioactivities, including anti-inflammatory, anti-tumor, and antiviral properties. It also exhibits potential in wound healing and skincare applications. Its applications extend to natural product research and the development of pharmaceuticals, cosmetics, and other health-related products, harnessing its potential as a versatile compound with diverse properties.
Catalog Number | M121023 |
CAS Number | 1721-69-3 |
Molecular Formula | C34H54O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-acetyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl]methyl acetate |
InChI | InChI=1S/C34H54O4/c1-21(2)24-12-17-34(20-37-22(3)35)19-18-32(8)25(29(24)34)10-11-27-31(7)15-14-28(38-23(4)36)30(5,6)26(31)13-16-33(27,32)9/h24-29H,1,10-20H2,2-9H3/t24-,25+,26-,27+,28-,29+,31-,32+,33+,34+/m0/s1 |
InChIKey | MIROITGPMGDCGI-MQXQNARFSA-N |
SMILES | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OC(=O)C)C)COC(=O)C |