For research use only. Not for therapeutic Use.
Betulinic Acid（Cat No.:I003634）is a naturally occurring pentacyclic triterpenoid essential for advanced cancer and antiviral research. Known for its potent anti-tumor, anti-HIV, and anti-inflammatory properties, it plays a crucial role in studying apoptosis and cellular pathways. This high-purity compound ensures precise and reliable analytical results, making it ideal for experimental setups focused on drug discovery and development. Betulinic Acid supports robust investigations into novel therapeutic agents, offering significant potential in oncology and infectious disease research, and enhancing the understanding of molecular mechanisms underlying its diverse biological activities.
| Catalog Number | I003634 |
| CAS Number | 472-15-1 |
| Synonyms | (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| Molecular Formula | C30H48O3 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IC50 | 1.4 μM (EC50, HIV1) |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| InChI | InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
| InChIKey | QGJZLNKBHJESQX-FZFNOLFKSA-N |
| SMILES | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C(=O)O |
