For research use only. Not for therapeutic Use.
(+)-Betulonic Acid(Cat No.:R063708)is a naturally derived triterpenoid with promising pharmacological properties, extracted primarily from Betula species. Known for its potent anti-inflammatory, antiviral, and anticancer activities, it acts by modulating key cellular pathways, including apoptosis and oxidative stress mechanisms. (+)-Betulonic Acid also exhibits antimicrobial properties, making it valuable in combating resistant pathogens. Its high stability and biocompatibility enhance its potential for drug development. Current research focuses on its therapeutic applications in chronic diseases and its role as a precursor for synthesizing bioactive derivatives in medicinal chemistry.
Catalog Number | R063708 |
CAS Number | 4481-62-3 |
Synonyms | 3-Oxo-lup-20(30)-en-28-oic Acid; 3-Oxobetulinic Acid; 3-Oxolup-20(29)-en-28-oic Acid; Betulonic Acid; Betunolic Acid; Liquidambaric acid; Liquidambronic Acid; MJ 347-RS; NSC 152534; (1R,3aS,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-Pentamethyl-9 |
Molecular Formula | C30H46O3 |
Purity | ≥95% |
Target | Parasite |
Storage | 3 years -20℃ powder |
IUPAC Name | (1R,3aS,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid |
InChI | InChI=1S/C30H46O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-22,24H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,24+,27-,28+,29+,30-/m0/s1 |
InChIKey | SLJTWDNVZKIDAU-SVAFSPIFSA-N |
SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CCC(=O)C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)C)C(=O)O |