For research use only. Not for therapeutic Use.
Bevurogant (BI 730357) is a retinoid-related orphan receptor-gamma t (RORγt) antagonist. Bevurogant can be used for the research of chronic inflammatory diseases[1].
| Catalog Number | I023313 |
| CAS Number | 1817773-66-2 |
| Synonyms | 8-[(1S)-1-cyclopropylethyl]-2-(4-cyclopropyl-6-methylpyrimidin-5-yl)-6-[(5-methylsulfonylpyridin-2-yl)methylamino]pteridin-7-one |
| Molecular Formula | C26H28N8O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C26H28N8O3S/c1-14-21(22(17-6-7-17)31-13-30-14)23-29-12-20-25(33-23)34(15(2)16-4-5-16)26(35)24(32-20)28-10-18-8-9-19(11-27-18)38(3,36)37/h8-9,11-13,15-17H,4-7,10H2,1-3H3,(H,28,32)/t15-/m0/s1 |
| InChIKey | HVVHIBHBDCYLDI-HNNXBMFYSA-N |
| SMILES | CC1=C(C(=NC=N1)C2CC2)C3=NC=C4C(=N3)N(C(=O)C(=N4)NCC5=NC=C(C=C5)S(=O)(=O)C)C(C)C6CC6 |
| Reference | [1]. BAKONYI J, et, al. Compounds as modulators of ror gamma. US20150291607A1. |
