For research use only. Not for therapeutic Use.
Bexarotene（Cat No.:A001128）is a synthetic retinoid and selective retinoid X receptor (RXR) agonist, primarily used in the treatment of cutaneous T-cell lymphoma (CTCL). By activating RXR, bexarotene influences gene expression involved in cell differentiation, apoptosis, and immune regulation, helping to control malignant cell growth. Its unique mechanism has also sparked research into neurodegenerative diseases like Alzheimer’s, where it may reduce amyloid-beta plaques. Bexarotene’s dual potential in oncology and neurology underscores its value as a therapeutic agent for targeted cancer treatment and innovative applications in brain health research.
| Catalog Number | A001128 |
| CAS Number | 153559-49-0 |
| Synonyms | LGD1069; Targretin |
| Molecular Formula | C24H28O2 |
| Purity | ≥95% |
| Target | Retinoid X Receptors |
| Solubility | >10.4mg/mL in DMSO |
| Storage | 3 years -20C powder |
| Overview of Clinical Research | Bexarotene is a p<span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>eroxisome proliferator-activated receptor agonist, a protein synthesis inhibitor and a retinoid X receptor agonist developed by L</span></span></span><span style=”font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>igand Pharmaceuticals. </span> |
| IUPAC Name | 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| InChI | InChI=1S/C24H28O2/c1-15-13-20-21(24(5,6)12-11-23(20,3)4)14-19(15)16(2)17-7-9-18(10-8-17)22(25)26/h7-10,13-14H,2,11-12H2,1,3-6H3,(H,25,26) |
| InChIKey | NAVMQTYZDKMPEU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C |
| Reference | <br /> |
