For research use only. Not for therapeutic Use.
BEZ235 Tosylate（Cat No.:I000176）is a potent dual inhibitor of phosphoinositide 3-kinase (PI3K) and mammalian target of rapamycin (mTOR), both crucial components of the PI3K/AKT/mTOR signaling pathway. By targeting these kinases, BEZ235 Tosylate disrupts key cellular processes such as growth, proliferation, and survival, making it a valuable tool in cancer research. It has shown efficacy in preclinical studies against various cancers, including breast, prostate, and gliomas. BEZ235 Tosylate is particularly studied for its ability to overcome resistance to other targeted therapies, offering insights into the development of combination cancer treatments.
| Catalog Number | I000176 |
| CAS Number | 1028385-32-1 |
| Synonyms | 4-methylbenzenesulfonic acid;2-methyl-2-[4-(3-methyl-2-oxo-8-quinolin-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]propanenitrile |
| Molecular Formula | C37H31N5O4S |
| Purity | ≥95% |
| Target | PI3K |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 4 nM/5 nM/7 nM/75 nM/6 nM(p110α/γ/δ/β/mTOR) |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-methyl-2-[4-(3-methyl-2-oxo-8-quinolin-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]propanenitrile |
| InChI | InChI=1S/C30H23N5O.C7H8O3S/c1-30(2,18-31)22-9-11-23(12-10-22)35-28-24-15-19(21-14-20-6-4-5-7-25(20)32-16-21)8-13-26(24)33-17-27(28)34(3)29(35)36;1-6-2-4-7(5-3-6)11(8,9)10/h4-17H,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | FWURTHAUPVXZHW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)(C#N)C1=CC=C(C=C1)N2C3=C4C=C(C=CC4=NC=C3N(C2=O)C)C5=CC6=CC=CC=C6N=C5 |
| Reference | <p style=/line-height:25px/> |
