For research use only. Not for therapeutic Use.
Bezafibrate-d6(Cat No.:S000356) is a deuterated form of bezafibrate, where six hydrogen atoms are replaced with deuterium. Bezafibrate is a fibric acid derivative used primarily to treat hyperlipidemia, reducing cholesterol and triglyceride levels in the blood. Deuteration increases the stability of bezafibrate, facilitating detailed pharmacokinetic and metabolic research. This allows scientists to more accurately track how bezafibrate is absorbed, distributed, metabolized, and excreted in the body.
Catalog Number | S000356 |
CAS Number | 1219802-74-0 |
Molecular Formula | C19H14D6ClNO4 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
IUPAC Name | 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
InChI | InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24)/i1D3,2D3 |
InChIKey | IIBYAHWJQTYFKB-WFGJKAKNSA-N |
SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |