For research use only. Not for therapeutic Use.
BHQ-1 NHS (Cat No.:I041127) is a fluorescent quenching reagent commonly used in molecular biology and bioanalytical applications. It contains an NHS ester group that enables covalent attachment to primary amines on biomolecules, such as proteins or nucleic acids. Upon incorporation into molecular probes, BHQ-1 efficiently quenches fluorescence from nearby fluorophores, enhancing the specificity and sensitivity of detection assays, such as real-time PCR. Its optimal use lies in applications requiring precise control of fluorescence signal dynamics, such as in various diagnostic and research settings.
| CAS Number | 916753-61-2 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 4-[4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]butanoate |
| Molecular Formula | C30H31N7O7 |
| Purity | ≥95% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]-N-methylanilino]butanoate |
| InChI | InChI=1S/C30H31N7O7/c1-19-7-12-23(26(16-19)37(41)42)32-33-24-18-27(43-4)25(17-20(24)2)34-31-21-8-10-22(11-9-21)35(3)15-5-6-30(40)44-36-28(38)13-14-29(36)39/h7-12,16-18H,5-6,13-15H2,1-4H3 |
| InChIKey | QIDPAHFSJZFKAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N=NC2=CC(=C(C=C2C)N=NC3=CC=C(C=C3)N(C)CCCC(=O)ON4C(=O)CCC4=O)OC)[N+](=O)[O-] |
