For research use only. Not for therapeutic Use.
BI-1622（Cat No.:I043354）is an investigational small molecule being studied for its potential therapeutic applications, particularly in oncology. It is designed to target specific molecular pathways involved in cancer cell growth, survival, and metastasis. BI-1622 works by inhibiting key proteins or enzymes that promote tumor progression and resistance to treatment. Ongoing research focuses on evaluating its efficacy, safety, and potential in various cancer types, including solid tumors. If successful, BI-1622 could offer a promising new treatment option for patients with cancers that are resistant to existing therapies or have limited treatment options.
| CAS Number | 2681392-19-6 |
| Synonyms | 1-[4-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrimido[5,4-d]pyrimidin-6-yl]piperazin-1-yl]prop-2-en-1-one |
| Molecular Formula | C26H24N10O2 |
| Purity | ≥95% |
| IUPAC Name | 1-[4-[4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrimido[5,4-d]pyrimidin-6-yl]piperazin-1-yl]prop-2-en-1-one |
| InChI | InChI=1S/C26H24N10O2/c1-3-23(37)34-8-10-35(11-9-34)26-27-14-20-24(33-26)25(30-15-28-20)32-18-4-5-21(17(2)12-18)38-19-6-7-36-22(13-19)29-16-31-36/h3-7,12-16H,1,8-11H2,2H3,(H,28,30,32) |
| InChIKey | KXUBSQUYDKKQTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC2=NC=NC3=CN=C(N=C32)N4CCN(CC4)C(=O)C=C)OC5=CC6=NC=NN6C=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
