For research use only. Not for therapeutic Use.
BI-Dime (Cat.No:L004123) is a significant chemical compound with applications in catalysis and materials science. Its unique molecular structure imparts specialized reactivity, making it invaluable in various chemical processes. This compound serves as a crucial catalyst in the synthesis of complex molecules, particularly in the field of organic chemistry.
Catalog Number | L004123 |
CAS Number | 1373432-09-7 |
Molecular Formula | C19H23O3P |
Purity | ≥95% |
IUPAC Name | (3S)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-2H-1,3-benzoxaphosphole |
InChI | InChI=1S/C19H23O3P/c1-19(2,3)23-12-22-16-11-6-8-13(18(16)23)17-14(20-4)9-7-10-15(17)21-5/h6-11H,12H2,1-5H3/t23-/m1/s1 |
InChIKey | BWPDUHMFZCEKIP-HSZRJFAPSA-N |
SMILES | CC(C)(C)[P@@]1COC2=CC=CC(=C21)C3=C(C=CC=C3OC)OC |