For research use only. Not for therapeutic Use.
Nintedanib(Cat No.:I004473), also known as BIBF 1120, is a potent inhibitor of multiple angiokinase receptors. It targets and inhibits the activity of vascular endothelial growth factor receptors (VEGFR) 1, 2, and 3, fibroblast growth factor receptors (FGFR) 1, 2, and 3, and platelet-derived growth factor receptors (PDGFR) α and β. By inhibiting these receptors, nintedanib disrupts signaling pathways involved in angiogenesis, the formation of new blood vessels. This mechanism of action makes nintedanib useful in the treatment of certain types of cancer, including non-small cell lung cancer and idiopathic pulmonary fibrosis, as well as other fibrotic and neovascular diseases.
| Catalog Number | I004473 |
| CAS Number | 656247-17-5 |
| Synonyms | methyl (3Z)-3-[[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]anilino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
| Molecular Formula | C31H33N5O4 |
| Purity | ≥95% |
| Target | PDGFR |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | methyl 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
| InChI | InChI=1S/C31H33N5O4/c1-34-15-17-36(18-16-34)20-27(37)35(2)24-12-10-23(11-13-24)32-29(21-7-5-4-6-8-21)28-25-14-9-22(31(39)40-3)19-26(25)33-30(28)38/h4-14,19,33,38H,15-18,20H2,1-3H3 |
| InChIKey | CPMDPSXJELVGJG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC(=O)N(C)C2=CC=C(C=C2)N=C(C3=CC=CC=C3)C4=C(NC5=C4C=CC(=C5)C(=O)OC)O |
| Reference | 1: Gori B, Ricciardi S, Fulvi A, Intagliata S, Del Signore E, de Marinis F. New <br> 2: Reck M. BIBF 1120 for the treatment of non-small cell lung cancer. Expert Opin <br> 3: du Bois A, Huober J, Stopfer P, Pfisterer J, Wimberger P, Loibl S, Reichardt <br> <br> 5: Miyazaki K, Collins DJ, Walker-Samuel S, Taylor JN, Padhani AR, Leach MO, Koh <br> |
