For research use only. Not for therapeutic Use.
BIC1 (Cat No.:I012776) is a protein involved in the regulation of immune responses and apoptosis. It plays a critical role in B-cell activation and differentiation, contributing to the proper functioning of the immune system. BIC1 interacts with various signaling pathways, including those involved in cell survival and inflammatory responses. It has been studied for its potential involvement in autoimmune diseases and certain cancers, as dysregulation of BIC1 expression can lead to abnormal immune activation or tumor progression. Ongoing research is exploring its therapeutic potential in these contexts.
| Catalog Number | I012776 |
| CAS Number | 433249-32-2 |
| Synonyms | 1-[2-(1H-Benzimidazol-2-ylthio)ethyl]-1,3-dihydro-3-methyl-2H-benzimidazole-2-thione; BRD2-interactive compound-1 |
| Molecular Formula | C17H16N4S2 |
| Purity | ≥95% |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-3-methylbenzimidazole-2-thione |
| InChI | InChI=1S/C17H16N4S2/c1-20-14-8-4-5-9-15(14)21(17(20)22)10-11-23-16-18-12-6-2-3-7-13(12)19-16/h2-9H,10-11H2,1H3,(H,18,19) |
| InChIKey | KDPSGIFCBZTBEZ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2N(C1=S)CCSC3=NC4=CC=CC=C4N3 |
