For research use only. Not for therapeutic Use.
Bicyclo[2.2.1]heptanemethanol(Cat No.:L007897), with the chemical formula C8H14O. It is a bicyclic compound featuring a heptane ring fused with a cyclopropane ring and an attached hydroxyl group. This structure imparts unique properties, making it valuable in organic synthesis and medicinal chemistry. Bicyclo[2.2.1]heptanemethanol and its derivatives serve as important intermediates in the synthesis of pharmaceuticals, fragrances, and specialized chemicals. Researchers utilize its unique bicyclic structure to design and synthesize complex molecules, contributing to advancements in drug discovery and the creation of novel organic compounds for various industrial applications.
CAS Number | 2064-02-0 |
Molecular Formula | C8H14O |
Purity | ≥95% |
IUPAC Name | 1-bicyclo[2.2.1]heptanylmethanol |
InChI | InChI=1S/C8H14O/c9-6-8-3-1-7(5-8)2-4-8/h7,9H,1-6H2 |
InChIKey | HLJSJYHFIJLTAX-UHFFFAOYSA-N |
SMILES | C1CC2(CCC1C2)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |