For research use only. Not for therapeutic Use.
Bifenazate-diazene（Cat No.:I015383） is a significant degradation product that forms when Bifenazate, a selective carbamate acaricide and insecticide, undergoes degradation. Bifenazate is specifically designed to target and control mite infestations in various crops. It acts by inhibiting the respiratory system of mites, leading to their death. Bifenazate-diazene is an intermediate compound that may result from the breakdown of Bifenazate in the environment. Understanding the degradation products of Bifenazate is important for assessing its environmental impact and ensuring the effective use of this acaricide and insecticide in agricultural practices.
| Catalog Number | I015383 |
| CAS Number | 149878-40-0 |
| Molecular Formula | C₁₇H₁₈N₂O₃ |
| Purity | ≥95% |
| Target | Drug Metabolite |
| IUPAC Name | propan-2-yl N-(2-methoxy-5-phenylphenyl)iminocarbamate |
| InChI | InChI=1S/C17H18N2O3/c1-12(2)22-17(20)19-18-15-11-14(9-10-16(15)21-3)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChIKey | AGTBLMHWQIEASU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)N=NC1=C(C=CC(=C1)C2=CC=CC=C2)OC |
| Reference | [1]. Hamdache S, et al. Unravelling the reactivity of bifenazate in water and on vegetables: Kinetics and byproducts. Sci Total Environ. 2018;636:107-114. |
